CAS 39124-20-4

4-aminotetrahydro-2H-pyran-4-carboxylic acid

Description:

4-Aminotetrahydro-2H-pyran-4-carboxylic acid, with the CAS number 39124-20-4, is a heterocyclic organic compound characterized by its pyran ring structure, which includes both an amino group and a carboxylic acid functional group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the carboxylic acid group. The amino group contributes to its basicity and potential reactivity in various chemical reactions, making it a valuable intermediate in organic synthesis. Its structure allows for the formation of hydrogen bonds, which can influence its physical properties and interactions with other molecules. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Overall, 4-aminotetrahydro-2H-pyran-4-carboxylic acid is notable for its unique structural features and potential applications in medicinal chemistry and organic synthesis.

Formula: C₆H₁₁NO₃

InChI: InChI=1/C6H11NO3/c7-6(5(8)9)1-3-10-4-2-6/h1-4,7H2,(H,8,9)

SMILES: C1COCCC1(C(=O)O)N

Synonyms:

• 2H-pyran-4-carboxylic acid, 4-aminotetrahydro-
• 4-Aminooxane-4-Carboxylic Acid

4-Aminotetrahydro-2H-pyran-4-carboxylic acid

CAS: 39124-20-4

Formula: C₆H₁₁NO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 145.1564

Ref: IN-DA0033WW

4-Aminotetrahydropyran-4-carboxylic acid

CAS: 39124-20-4

4-Aminotetrahydropyran-4-carboxylic acid

Formula: C₆H₁₁NO₃

Purity: 96%

Molecular weight: 145.15644

Ref: 54-OR480401

4-Aminotetrahydro-2H-pyran-4-carboxylic acid

CAS: 39124-20-4

Formula: C₆H₁₁NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 145.158

Ref: 10-F066272

H-ThpGly-OH

CAS: 39124-20-4

4-Aminotetrahydropyran-4-carboxylic Acid

Formula: C₆H₁₁NO₃

Purity: 96%

Molecular weight: 145.16

Ref: IN-DG94298

4-Aminotetrahydro-2h-pyran-4-carboxylic acid

Controlled Product

CAS: 39124-20-4

Applications 4-Aminotetrahydro-2H-pyran-4-carboxylic acid has been examined as potential inhibitor of the enzyme S-adenosylmethionine (AdoMet) synthetase.
References Lavrador, Karine., et al.: Bioorganic Med. Chem. Lett.,  8, 1629 (1998);

Formula: C₁₆H₁₉NO₄

Color and Shape: Neat

Molecular weight: 289.326

Ref: TR-A617700