CymitQuimica logo

CAS 39169-92-1

:

4-[acetyl(methyl)amino]benzenesulfonyl chloride

Description:
4-[Acetyl(methyl)amino]benzenesulfonyl chloride, with the CAS number 39169-92-1, is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and utility in organic synthesis. This compound features an aromatic ring substituted with an acetyl(methyl)amino group, contributing to its potential as a versatile intermediate in the synthesis of various pharmaceuticals and agrochemicals. The presence of the sulfonyl chloride group makes it a strong electrophile, allowing it to participate in nucleophilic substitution reactions. It is typically a solid at room temperature and may be sensitive to moisture, requiring careful handling and storage conditions to prevent hydrolysis. Additionally, due to the presence of the sulfonyl chloride moiety, it can release hydrochloric acid upon reaction, necessitating appropriate safety precautions during its use in laboratory settings. Overall, this compound is significant in synthetic organic chemistry for its reactivity and functional group compatibility.
Formula:C9H10ClNO3S
InChI:InChI=1/C9H10ClNO3S/c1-7(12)11(2)8-3-5-9(6-4-8)15(10,13)14/h3-6H,1-2H3
InChI key:FJXBSNLZPGJSAT-UHFFFAOYSA-N
SMILES:CC(=O)N(C)c1ccc(cc1)S(=O)(=O)Cl
Found 4 products.