CymitQuimica logo

CAS 392-22-3

:

2-Chloro-6-fluorocinnamic acid

Description:
2-Chloro-6-fluorocinnamic acid is an organic compound characterized by its aromatic structure, which includes a cinnamic acid backbone with a chlorine atom at the second position and a fluorine atom at the sixth position of the phenyl ring. This compound typically appears as a white to off-white solid and is known for its moderate solubility in organic solvents. It exhibits both acidic and aromatic properties, making it a versatile intermediate in organic synthesis. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity, stability, and potential applications in pharmaceuticals and agrochemicals. Additionally, 2-chloro-6-fluorocinnamic acid may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, due to the electrophilic nature of the aromatic ring. Its unique structure allows for potential use in the development of novel compounds with specific biological activities. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H6ClFO2
InChI:InChI=1/C9H6ClFO2/c10-7-2-1-3-8(11)6(7)4-5-9(12)13/h1-5H,(H,12,13)/b5-4-
InChI key:NDWALECYVLNBQG-SNAWJCMRSA-N
SMILES:c1cc(c(/C=C\C(=O)O)c(c1)F)Cl
Synonyms:
  • 3-(2-Chloro-6-fluorophenyl)acrylic acid
  • (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoic acid
  • (2E)-3-(2-chloro-6-fluorophenyl)prop-2-enoate
  • (Z)-3-(2-chloro-6-fluoro-phenyl)prop-2-enoic acid
Found 5 products.