CAS 39201-75-7
:3,5-Dimethoxy-4-(2-propen-1-yloxy)benzeneethanamine
Description:
3,5-Dimethoxy-4-(2-propen-1-yloxy)benzeneethanamine, with the CAS number 39201-75-7, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two methoxy groups and an allyloxy group. This compound features an ethylamine side chain, contributing to its potential biological activity. The presence of methoxy groups typically enhances the lipophilicity of the molecule, which may influence its interaction with biological systems. The allyloxy group can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry. Additionally, the compound may exhibit properties relevant to pharmacology, although specific biological activities would require further investigation. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 3,5-Dimethoxy-4-(2-propen-1-yloxy)benzeneethanamine represents a versatile structure that could be explored for various applications in medicinal chemistry and materials science.
Formula:C13H19NO3
InChI:InChI=1S/C13H19NO3/c1-4-7-17-13-11(15-2)8-10(5-6-14)9-12(13)16-3/h4,8-9H,1,5-7,14H2,2-3H3
InChI key:InChIKey=JNUAYHHGCXYBHX-UHFFFAOYSA-N
SMILES:O(CC=C)C1=C(OC)C=C(CCN)C=C1OC
Synonyms:- 3,5-Dimethoxy-4-(2-propen-1-yloxy)benzeneethanamine
- 3,5-Dimethoxy-4-(2-propenyloxy)benzeneethanamine
- 3,5-Dimethoxy-4-(allyloxy)phenethylamine
- Benzeneethanamine, 3,5-dimethoxy-4-(2-propen-1-yloxy)-
- Benzeneethanamine, 3,5-dimethoxy-4-(2-propenyloxy)-
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Allylescaline
CAS:Controlled ProductAllylescaline is a psychoactive drug and psychedelic that belongs to the group of phenethylamines. It is structurally related to both Valerylfentanyl and Furanylfentanyl, with the latter being more potent than Allylescaline. Allylescaline has been shown to be fatal in rats at high doses. It also activates serotonergic neurons in the central nervous system, which are involved in mood regulation and control of appetite, sleep, memory, as well as some autonomic functions. The mechanism of action of Allylescaline is mediated by serotonin 5-HT1A receptors. Allylescaline has been shown to have psychoactive properties and produces a mild psychedelic effects similar to those of mescaline and lysergic acid diethylamide (LSD). These effects are due to its interaction with serotonin 5-HT2A receptors.br>Allylescaline can also bind to cannabinoid CB1 receptors leading to an increase in dopamine release in theFormula:C13H19NO3Purity:Min. 95%Molecular weight:237.29 g/mol

