CAS 39219-28-8: Promestriene
Description:Promestriene is a synthetic estrogen, primarily used in gynecological applications. It is characterized by its ability to mimic the effects of natural estrogen in the body, making it useful for treating various conditions related to estrogen deficiency, such as atrophic vaginitis and other menopausal symptoms. Promestriene is known for its local action, often administered topically, which minimizes systemic side effects compared to other estrogen therapies. The compound has a relatively low molecular weight and is lipophilic, allowing for effective absorption through mucosal membranes. Its chemical structure features a phenolic ring, which is typical of many steroidal estrogens, contributing to its biological activity. Promestriene is generally well-tolerated, but like all hormonal treatments, it may have potential side effects, including the risk of thromboembolic events. As with any medication, its use should be guided by a healthcare professional, considering individual patient needs and health conditions.
Formula:C22H32O2
InChI:InChI=1S/C22H32O2/c1-4-13-24-16-6-8-17-15(14-16)5-7-19-18(17)11-12-22(2)20(19)9-10-21(22)23-3/h6,8,14,18-21H,4-5,7,9-13H2,1-3H3/t18-,19-,20+,21+,22+/m1/s1
InChI key:InChIKey=IUWKNLFTJBHTSD-AANPDWTMSA-N
SMILES:O(C1=CC=C2C(=C1)CCC3C2CCC4(C)C(OC)CCC34)CCC
- Synonyms:
- (17Beta)-17-Methoxy-3-Propoxyestra-1,3,5(10)-Triene
- (17β)-17-Methoxy-3-propoxyestra-1,3,5(10)-triene
- 17-Methoxy-3-Propoxyestra-1,3,5(10)-Triene
- 3-Propoxy-17Beta-Methoxy-1,3,5(10)-Estratriene
- 3-Propoxy-17β-methoxyestra-1,3,5(10)-triene
- Estra-1,3,5(10)-triene, 17-methoxy-3-propoxy-, (17β)-
- Promestriene
