CAS 3922-40-5: 4,7-Dihydroxy-1,10-phenanthroline
Description:4,7-Dihydroxy-1,10-phenanthroline, with the CAS number 3922-40-5, is an organic compound characterized by its phenanthroline structure, which consists of three fused aromatic rings. This compound features two hydroxyl (-OH) groups located at the 4 and 7 positions of the phenanthroline framework, contributing to its solubility and reactivity. It is typically a crystalline solid that exhibits strong chelating properties, allowing it to form stable complexes with various metal ions, particularly transition metals. This property makes it useful in analytical chemistry, especially in the determination of metal concentrations in various samples. Additionally, 4,7-dihydroxy-1,10-phenanthroline can exhibit fluorescence and has potential applications in materials science and biochemistry. Its ability to participate in redox reactions also highlights its significance in electrochemical studies. Overall, this compound is valued for its versatility in both research and industrial applications, particularly in coordination chemistry and as a reagent in various chemical analyses.
Formula:C12H8N2O2
InChI:InChI=1S/C12H8N2O2/c15-9-3-5-13-11-7(9)1-2-8-10(16)4-6-14-12(8)11/h1-6H,(H,13,15)(H,14,16)
InChI key:InChIKey=SLIBCJURSADKPV-UHFFFAOYSA-N
SMILES:OC=1C=CN=C2C=3N=CC=C(O)C3C=CC12
- Synonyms:
- 1,10-Dihydro-1,10-Phenanthroline-4,7-Dione
- 1,10-Dihydro-1,10-Phenanthroline-4,7-Quinone
- 1,10-Phenanthroline-4,7-diol
- Timtec-Bb Sbb008750
- 4,7-Dihydroxy-1,10-phenanthroline
