CAS 3922-40-5
:4,7-Dihydroxy-1,10-phenanthroline
Description:
4,7-Dihydroxy-1,10-phenanthroline, with the CAS number 3922-40-5, is an organic compound characterized by its phenanthroline structure, which consists of three fused aromatic rings. This compound features two hydroxyl (-OH) groups located at the 4 and 7 positions of the phenanthroline framework, contributing to its solubility and reactivity. It is typically a crystalline solid that exhibits strong chelating properties, allowing it to form stable complexes with various metal ions, particularly transition metals. This property makes it useful in analytical chemistry, especially in the determination of metal concentrations in various samples. Additionally, 4,7-dihydroxy-1,10-phenanthroline can exhibit fluorescence and has potential applications in materials science and biochemistry. Its ability to participate in redox reactions also highlights its significance in electrochemical studies. Overall, this compound is valued for its versatility in both research and industrial applications, particularly in coordination chemistry and as a reagent in various chemical analyses.
Formula:C12H8N2O2
InChI:InChI=1S/C12H8N2O2/c15-9-3-5-13-11-7(9)1-2-8-10(16)4-6-14-12(8)11/h1-6H,(H,13,15)(H,14,16)
InChI key:InChIKey=SLIBCJURSADKPV-UHFFFAOYSA-N
SMILES:OC=1C=2C(=C3C(=CC2)C(O)=CC=N3)N=CC1
Synonyms:- 1,10-Dihydro-1,10-Phenanthroline-4,7-Dione
- 1,10-Dihydro-1,10-Phenanthroline-4,7-Quinone
- 1,10-Phenanthroline-4,7-diol
- Timtec-Bb Sbb008750
- 4,7-Dihydroxy-1,10-phenanthroline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4,7-Dihydroxy-1,10-phenanthroline
CAS:Formula:C12H8N2O2Purity:>98.0%(HPLC)Color and Shape:White to Gray to Brown powder to crystalMolecular weight:212.214,7-Dihydroxy-1,10-phenanthroline
CAS:4,7-Dihydroxy-1,10-phenanthroline is used as a phenanthroline stain. Its iron(II) complex reacts rapidly with dissolved oxygen in aqueous solution, thereby it is utilized for the spectrophotometric determination of dissolved oxygen up to 20 ppm. This Thermo Scientific Chemicals brand product was orFormula:C12H8N2O2Color and Shape:Powder or crystals or crystalline powder, BrownMolecular weight:212.211,10-Phenanthroline-4,7-diol
CAS:Formula:C12H8N2O2Purity:95%Color and Shape:SolidMolecular weight:212.20414,7-Dihydroxy-1,10-phenanthroline
CAS:4,7-Dihydroxy-1,10-phenanthrolineFormula:C12H8N2O2Purity:98%Molecular weight:212.2084,7-Dihydroxy-1,10-phenanthroline
CAS:4,7-Dihydroxy-1,10-phenanthrolineFormula:C12H8N2O2Purity:97%Color and Shape:SolidMolecular weight:212.2071,10-Phenanthroline-4,7-diol
CAS:Formula:C12H8N2O2Purity:95%Color and Shape:Solid, White - Greyish reddish yellow powderMolecular weight:212.2084,7-Dihydroxy-1,10-phenanthroline
CAS:4,7-Dihydroxy-1,10-phenanthroline is an organometallic compound that has been shown to inhibit the growth of tumour cells. It is a protonated molecule and can be classified as a reactive intermediate. The reaction mechanism for this intermediate is nucleophilic attack by the hydroxy group on the carbon atom adjacent to the aromatic ring. This results in the formation of a cationic intermediate, which undergoes protonation to form the final product. 4,7-Dihydroxy-1,10-phenanthroline has been found to have anti-tumor effects against l1210 murine leukemia cell lines.Formula:C12H8N2O2Purity:Min. 95%Molecular weight:212.2 g/mol






