CymitQuimica logo

CAS 392714-61-3

:

4-(cyclooctylamino)-4-oxobutanoic acid

Description:
4-(Cyclooctylamino)-4-oxobutanoic acid is a chemical compound characterized by its unique structure, which includes a cyclooctyl group attached to an amino group and a ketone functional group. This compound features a butanoic acid backbone, which contributes to its acidic properties. The presence of the cyclooctyl group, a cyclic alkane with eight carbon atoms, imparts hydrophobic characteristics, influencing its solubility and interaction with biological membranes. The amino group can participate in hydrogen bonding, enhancing its potential as a ligand in various chemical reactions or biological applications. Additionally, the ketone functionality plays a crucial role in reactivity, allowing for potential transformations in synthetic pathways. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its specific applications and behavior would depend on the context of use, including its interactions with other molecules and its stability under various conditions.
Formula:C12H21NO3
InChI:InChI=1/C12H21NO3/c14-11(8-9-12(15)16)13-10-6-4-2-1-3-5-7-10/h10H,1-9H2,(H,13,14)(H,15,16)
InChI key:GGGQYDFERFYSMO-UHFFFAOYSA-N
SMILES:C1CCCC(CCC1)N=C(CCC(=O)O)O
Synonyms:
  • Butanoic Acid, 4-(Cyclooctylamino)-4-Oxo-
Found 3 products.