CAS 3943-89-3: Ethyl 3,4-dihydroxybenzoate
Description:Ethyl 3,4-dihydroxybenzoate, also known as ethyl gallate, is an organic compound characterized by its ester functional group derived from gallic acid. It appears as a white to off-white crystalline powder and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. The compound features two hydroxyl (-OH) groups on the benzene ring, contributing to its antioxidant properties, making it of interest in food preservation and cosmetic formulations. Ethyl 3,4-dihydroxybenzoate exhibits mild antimicrobial activity and is often studied for its potential health benefits, including anti-inflammatory and anticancer effects. Its chemical structure allows it to participate in various chemical reactions, including esterification and oxidation. Safety data indicates that it should be handled with care, as with many organic compounds, due to potential irritant properties. Overall, ethyl 3,4-dihydroxybenzoate is valued for its functional properties in various applications, particularly in the fields of pharmaceuticals and food science.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5,10-11H,2H2,1H3
InChI key:InChIKey=KBPUBCVJHFXPOC-UHFFFAOYSA-N
SMILES:O=C(OCC)C1=CC=C(O)C(O)=C1
- Synonyms:
- 3,4-Dihydroxybenzoic acid ethyl ester
- Benzoic acid, 3,4-dihydroxy-, ethyl ester
- Ethyl 3,4-dihydrobenzoate
- Ethyl protocatechuate
- NSC 619681
- NSC 86130
- Protocatechuic acid, ethyl ester
- Ethyl 3,4-dihydroxybenzoate
