CymitQuimica logo

CAS 394654-07-0

:

Butanoic acid,4-[(1-acetyl-2,3-dihydro-1H-indol-7-yl)amino]-4-oxo-

Description:
Butanoic acid, 4-[(1-acetyl-2,3-dihydro-1H-indol-7-yl)amino]-4-oxo- is a chemical compound characterized by its unique structure, which includes a butanoic acid moiety and an indole derivative. This compound features an amine linkage, connecting the butanoic acid to an indole ring that is substituted with an acetyl group. The presence of the 4-oxo group indicates a carbonyl functionality, contributing to its reactivity and potential biological activity. The indole structure is known for its role in various biological processes and can influence the compound's pharmacological properties. This compound may exhibit characteristics typical of both carboxylic acids and indole derivatives, such as solubility in organic solvents and potential interactions with biological targets. Its specific applications and behavior in chemical reactions would depend on the functional groups present and their spatial arrangement, which can affect its reactivity and interactions in biological systems. Overall, this compound represents a complex organic molecule with potential implications in medicinal chemistry and drug development.
Formula:C14H16N2O4
InChI:InChI=1S/C14H16N2O4/c1-9(17)16-8-7-10-3-2-4-11(14(10)16)15-12(18)5-6-13(19)20/h2-4H,5-8H2,1H3,(H,15,18)(H,19,20)
InChI key:ROCYRFIEWHKAQL-UHFFFAOYSA-N
SMILES:CC(=O)N1CCC2=C1C(=CC=C2)NC(=O)CCC(=O)O
Found 2 products.