CymitQuimica logo

CAS 396-02-1

:

2,4-Dichloro-7-(trifluoromethyl)quinazoline

Description:
2,4-Dichloro-7-(trifluoromethyl)quinazoline is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features two chlorine atoms at the 2 and 4 positions and a trifluoromethyl group at the 7 position, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of halogen substituents often enhances its reactivity and can influence its biological activity, making it of interest in pharmaceutical research and agrochemical applications. The compound may also demonstrate specific interactions with biological targets, which can be explored for potential therapeutic uses. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2,4-Dichloro-7-(trifluoromethyl)quinazoline is a notable compound in the field of medicinal chemistry and materials science.
Formula:C9H3Cl2F3N2
InChI:InChI=1S/C9H3Cl2F3N2/c10-7-5-2-1-4(9(12,13)14)3-6(5)15-8(11)16-7/h1-3H
InChI key:InChIKey=PRJBXUBPUYNFQF-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=C(C(F)(F)F)C=C2)N=C(Cl)N1
Synonyms:
  • Quinazoline, 2,4-dichloro-7-(trifluoromethyl)-
  • 2,4-Dichloro-7-(trifluoromethyl)quinazoline
Found 5 products.