CAS 39654-52-9
:rel-(10R,11R)-10,11-Dibromo-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-one
Description:
Rel-(10R,11R)-10,11-Dibromo-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both bromine substituents and a ketone functional group. This compound features a dibromo substitution at the 10 and 11 positions of the bicyclic framework, contributing to its reactivity and potential applications in organic synthesis. The stereochemistry indicated by the "rel-(10R,11R)" designation suggests specific spatial arrangements of the substituents, which can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity. The presence of the ketone group typically implies that the compound may participate in various chemical reactions, including nucleophilic additions and reductions. Additionally, the dibromo substitution can enhance the compound's electrophilic character, making it useful in further synthetic transformations. Overall, this compound's structural complexity and functional groups make it of interest in fields such as medicinal chemistry and materials science.
Formula:C15H10Br2O
InChI:InChI=1/C15H10Br2O/c16-13-9-5-1-3-7-11(9)15(18)12-8-4-2-6-10(12)14(13)17/h1-8,13-14H/t13-,14-/s2
InChI key:InChIKey=UXTYUOCJQGRAIG-ZCWZLOQUNA-N
SMILES:O=C1C=2C([C@H](Br)[C@@H](Br)C=3C1=CC=CC3)=CC=CC2
Synonyms:- 10,11-dibromo-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one
- 5H-Dibenzo[a,d]cyclohepten-5-one, 10,11-dibromo-10,11-dihydro-, (10R,11R)-rel-
- 5H-Dibenzo[a,d]cyclohepten-5-one, 10,11-dibromo-10,11-dihydro-, trans-
- rel-(10R,11R)-10,11-Dibromo-10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
10,11-Dibromo10,11-dihydro-5-dibenzosuberenone
CAS:Controlled ProductFormula:C15H10Br2OColor and Shape:NeatMolecular weight:366.047

