CymitQuimica logo

CAS 397308-78-0

:

2-(methylsulfanyl)-6-oxo-1,6-dihydropyrimidine-5-carboxylic acid

Description:
2-(Methylsulfanyl)-6-oxo-1,6-dihydropyrimidine-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which includes a methylsulfanyl group and a carboxylic acid functional group. This compound features a six-membered ring with two nitrogen atoms, contributing to its basicity and potential reactivity. The presence of the methylsulfanyl group enhances its solubility in organic solvents and may influence its biological activity. The carboxylic acid group provides acidic properties, allowing for potential interactions in biochemical pathways. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its practical applications. Overall, 2-(methylsulfanyl)-6-oxo-1,6-dihydropyrimidine-5-carboxylic acid represents a versatile structure with potential utility in various chemical and pharmaceutical contexts.
Formula:C6H6N2O3S
InChI:InChI=1/C6H6N2O3S/c1-12-6-7-2-3(5(10)11)4(9)8-6/h2H,1H3,(H,10,11)(H,7,8,9)
InChI key:MOAJQWKFKCJUKP-UHFFFAOYSA-N
SMILES:CSc1ncc(c(n1)O)C(=O)O
Synonyms:
  • 4-Hydroxy-2-(methylsulfanyl)pyrimidine-5-carboxylic acid
  • 5-Pyrimidinecarboxylic acid, 4-hydroxy-2-(methylthio)-
  • 4-Hydroxy-2-(methylthio)pyrimidine-5-carboxylicacid
Found 4 products.