CAS 39806-90-1
:1-Methyl-4-iodo-1H-pyrazole
Description:
1-Methyl-4-iodo-1H-pyrazole is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. The presence of a methyl group at the 1-position and an iodine atom at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the hydrophobic nature of the pyrazole ring and the iodine substituent. The iodine atom enhances the compound's reactivity, making it a useful intermediate in various organic synthesis reactions, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the methyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological targets. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental impact.
Formula:C4H5IN2
InChI:InChI=1/C4H5IN2/c1-7-3-4(5)2-6-7/h2-3H,1H3
SMILES:Cn1cc(cn1)I
Synonyms:- 4-Iodo-1-methyl-1H-pyrazole
- 4-Iodo-1-methylpyrazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Iodo-1-methylpyrazole
CAS:Formula:C4H5IN2Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:208.004-Iodo-1-methyl-1H-pyrazole
CAS:Formula:C4H5IN2Purity:98%Color and Shape:SolidMolecular weight:208.00044-Iodo-1-methyl-1H-pyrazole
CAS:4-Iodo-1-methyl-1H-pyrazoleFormula:C4H5IN2Purity:98%Color and Shape:Off-white Solid-PowderMolecular weight:208.000364-Iodo-1-methyl-1H-pyrazole
CAS:Formula:C4H5IN2Purity:97%Color and Shape:SolidMolecular weight:208.0024-Iodo-1-methylpyrazole
CAS:4-Iodo-1-methylpyrazole is a reductive agent that is used in organic synthesis. It can be used as a reducing agent for the conversion of aldehydes and ketones to alcohols. 4-Iodo-1-methylpyrazole can be crystallized from diethyl etherate and blood. The product yield from this reaction is high, but it requires an oxidant such as trifluoride or plavix to react with the diacetates. 4-Iodo-1-methylpyrazole can also be synthesized by reacting allylsilanes with iodine gas in the presence of a base. This synthesis method produces 4-iodo-1-methylpyrazole in good yield and with little difficulty.Formula:C4H5IN2Purity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow To Tan SolidMolecular weight:208 g/mol





