CymitQuimica logo

CAS 39824-26-5

:

6-Chloropurine-9-(2,3-isopropylidene)-b-d-ribfuraniside

Description:
6-Chloropurine-9-(2,3-isopropylidene)-β-D-ribofuranoside, with the CAS number 39824-26-5, is a nucleoside analog characterized by its purine base structure and a ribofuranoside sugar moiety. This compound features a chlorine atom at the 6-position of the purine ring, which can influence its biological activity and interaction with nucleic acid synthesis pathways. The isopropylidene group at the 9-position of the ribofuranoside enhances the stability of the molecule, making it less susceptible to hydrolysis. This structural modification can also affect its solubility and permeability, which are critical for its potential therapeutic applications. The compound may exhibit antiviral or anticancer properties, as many nucleoside analogs do, by interfering with nucleic acid metabolism in target cells. Its synthesis and characterization typically involve standard organic chemistry techniques, including protection and deprotection strategies for the sugar moiety. Overall, this compound represents a significant interest in medicinal chemistry for its potential roles in drug development.
Formula:C13H15ClN4O4
InChI:InChI=1/C13H15ClN4O4/c1-13(2)21-8-6(3-19)20-12(9(8)22-13)18-5-17-7-10(14)15-4-16-11(7)18/h4-6,8-9,12,19H,3H2,1-2H3
InChI key:VDYNZOUPLVQLRV-WOUKDFQISA-N
SMILES:CC1(C)OC2C(CO)OC(C2O1)n1cnc2c(Cl)ncnc12
Synonyms:
  • 6-chloro-9-[2,3-O-(1-methylethylidene)pentofuranosyl]-9H-purine
  • 6-Chloro-9-Beta-D-(2,3-Isopropylidene)Ribofuranosylpurine
  • 6-chloro-9-[2,3-O-(1-methylethylidene)-β-D-ribofuranosyl]-9H-purine
Found 8 products.