CymitQuimica logo

CAS 398491-61-7

:

tert-Butyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate

Description:
Tert-Butyl 3-amino-6,6-dimethyl-4,6-dihydropyrrolo[3,4-c]pyrazole-5(1H)-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrole and pyrazole moiety. This compound features a tert-butyl ester group, contributing to its solubility and stability in organic solvents. The presence of an amino group enhances its potential for biological activity, making it of interest in medicinal chemistry. The dimethyl groups on the pyrrolo structure may influence its steric properties and reactivity. Typically, compounds of this nature are evaluated for their pharmacological properties, including potential anti-inflammatory or anticancer activities. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological function. As with many organic compounds, its stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique scaffold for further chemical modifications and potential therapeutic applications.
Formula:C12H20N4O2
InChI:InChI=1/C12H20N4O2/c1-11(2,3)18-10(17)16-6-7-8(12(16,4)5)14-15-9(7)13/h6H2,1-5H3,(H3,13,14,15)
InChI key:XOQXOJPUZGHMLL-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1Cc2c(C1(C)C)[nH][nH]c2=N
Synonyms:
  • Pyrrolo[3,4-c]pyrazole-5(1H)-carboxylicacid, 3-amino-4,6-dihydro-6,6-dimethyl-, 1,1-dimethylethyl ester
Found 4 products.