CAS 3988-77-0
:Cinnamoylthiophene
Description:
Cinnamoylthiophene, with the CAS number 3988-77-0, is an organic compound that features a thiophene ring substituted with a cinnamoyl group. This compound typically exhibits characteristics associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the thiophene moiety. Cinnamoylthiophene may display interesting electronic properties, making it a candidate for applications in organic electronics and materials science. The presence of the cinnamoyl group can impart specific functional properties, such as potential biological activity or photochemical behavior. In terms of solubility, compounds of this nature are often soluble in organic solvents, which can facilitate their use in various chemical reactions and applications. Additionally, the compound may exhibit distinct UV-Vis absorption characteristics due to its conjugated system, which can be useful in analytical chemistry for detection and quantification. Overall, cinnamoylthiophene represents a unique structure that combines features of both thiophene and aromatic systems, leading to diverse potential applications in research and industry.
Formula:C13H10OS
InChI:InChI=1/C13H10OS/c14-12(13-7-4-10-15-13)9-8-11-5-2-1-3-6-11/h1-10H/b9-8+
InChI key:DDNPADUKGZMCHV-CMDGGOBGSA-N
SMILES:C1=CC=C(C=C1)/C=C/C(=O)C2=CC=CS2
Synonyms:- 2-Cinnamoylthiophene
- 3-Phenyl-1-(Thiophen-2-Yl)Prop-2-En-1-One
- (2E)-3-phenyl-1-thiophen-2-ylprop-2-en-1-one
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Cinnamoylthiophene
CAS:Formula:C13H10OSPurity:>98.0%(GC)Color and Shape:White to Yellow to Green powder to crystalMolecular weight:214.283-Phenyl-1-(thien-2-yl)prop-2-en-1-one
CAS:3-Phenyl-1-(thien-2-yl)prop-2-en-1-oneFormula:C13H10OSPurity:98%Color and Shape:Solid-PowderMolecular weight:214.28293-Phenyl-1-(2-Thienyl)-2-Propen-1-One
CAS:Formula:C13H10OSPurity:98%Color and Shape:SolidMolecular weight:214.28293-Phenyl-1-(thiophen-2-yl)prop-2-en-1-one
CAS:3-Phenyl-1-(thiophen-2-yl)prop-2-en-1-oneFormula:C13H10OSPurity:98%Molecular weight:214.282-Cinnamoylthiophene
CAS:2-Cinnamoylthiophene is a synthetic compound that has been shown to have an apoptotic effect on cancer cells in culture. It is produced by the reaction of 2-aminothiophenol with acetic anhydride and cinnamic acid. The molecular structure of 2-cinnamoylthiophene has been determined using nuclear magnetic resonance (NMR) spectroscopy and quantum chemical calculations. This molecule is oxidized by hydrogen peroxide to generate reactive intermediates, which then react with DNA bases to form DNA adducts. These adducts are detected by the tetrazolium dye MTT, which is used as a cell viability assay. 2-Cinnamoylthiophene also contains functional groups that can be used for further study.
Formula:C13H10OSPurity:Min. 95%Molecular weight:214.28 g/mol




