CymitQuimica logo

CAS 39890-95-4

:

2-Chloro-6-(trifluoromethyl)pyridine

Description:
2-Chloro-6-(trifluoromethyl)pyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with a chlorine atom at the 2-position and a trifluoromethyl group at the 6-position. This compound has a molecular formula of C7H4ClF3N and features a distinctive trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and reactivity. The presence of the chlorine atom introduces electrophilic characteristics, making it a useful intermediate in various chemical syntheses, particularly in the pharmaceutical and agrochemical industries. 2-Chloro-6-(trifluoromethyl)pyridine is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its stability under standard conditions. It is soluble in organic solvents but has limited solubility in water. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Its unique structure and reactivity make it a valuable compound in synthetic organic chemistry.
Formula:C6H3ClF3N
InChI:InChI=1/C6H3ClF3N/c7-5-3-1-2-4(11-5)6(8,9)10/h1-3H
InChI key:ADVQMCQMDHBTHJ-UHFFFAOYSA-N
SMILES:c1cc(C(F)(F)F)nc(c1)Cl
Synonyms:
  • 2-Chloro-6-trifluoromethylpyridine
  • 2-Chloro-6-trifluoromethylpridine
Found 6 products.