CymitQuimica logo

CAS 400-52-2

:

tert-butyl trifluoroacetate

Description:
Tert-butyl trifluoroacetate is an organic compound characterized by its ester functional group, specifically derived from trifluoroacetic acid and tert-butanol. It is typically a colorless liquid with a distinctive odor. The presence of trifluoromethyl groups imparts unique properties, including increased lipophilicity and volatility. This compound is known for its stability under normal conditions but can undergo hydrolysis in the presence of water, leading to the formation of trifluoroacetic acid and tert-butanol. Tert-butyl trifluoroacetate is often utilized as a reagent in organic synthesis, particularly in the preparation of various fluorinated compounds and as a protecting group for alcohols in synthetic pathways. Its low toxicity and relatively simple handling make it a valuable tool in chemical research and industrial applications. However, appropriate safety measures should be taken due to its potential irritant properties and the environmental impact of trifluoroacetic acid.
Formula:C6H9F3O2
InChI:InChI=1/C6H9F3O2/c1-5(2,3)11-4(10)6(7,8)9/h1-3H3
InChI key:UQJLSMYQBOJUGG-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)C(F)(F)F
Synonyms:
  • Acetic Acid, 2,2,2-Trifluoro-, 1,1-Dimethylethyl Ester
  • Acetic acid, trifluoro-, 1,1-dimethylethyl ester
  • Acetic acid, trifluoro-, tert-butyl ester
Found 3 products.