CymitQuimica logo

CAS 40000-20-2

:

5-Bromo-1,10-phenanthroline

Description:
5-Bromo-1,10-phenanthroline is an organic compound characterized by its structure, which includes a phenanthroline backbone with a bromine substituent at the 5-position. This compound is typically a solid at room temperature and is known for its ability to form chelates with metal ions, making it useful in coordination chemistry and analytical applications. It exhibits strong absorbance in the ultraviolet-visible (UV-Vis) spectrum, which can be utilized in spectrophotometric analyses. The presence of the bromine atom enhances its reactivity and can influence its solubility in various solvents. 5-Bromo-1,10-phenanthroline is often employed in research settings, particularly in studies involving transition metals, due to its ability to stabilize metal complexes. Additionally, it may exhibit fluorescence properties, which can be advantageous in various detection methods. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C12H7BrN2
InChI:InChI=1S/C12H7BrN2/c13-10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H
InChI key:InChIKey=GWKGPQCKIBRXGW-UHFFFAOYSA-N
SMILES:BrC1=C2C(=C3C(=C1)C=CC=N3)N=CC=C2
Synonyms:
  • 1,10-Phenanthroline, 5-bromo-
  • 5-Bromo-1,10-phenanthroline
Found 6 products.