CAS 40015-11-0

5-Chloro-3-(methylthio)-1H-indole

Description:

5-Chloro-3-(methylthio)-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a chlorine atom at the 5-position and a methylthio group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent used. It is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the field of medicinal chemistry. The chlorine substituent can influence the compound's reactivity and interaction with biological targets, while the methylthio group may enhance lipophilicity. As with many indole derivatives, it may exhibit fluorescence properties, making it useful in various analytical applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 5-Chloro-3-(methylthio)-1H-indole is a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₉H₈ClNS

InChI: InChI=1S/C9H8ClNS/c1-12-9-5-11-8-3-2-6(10)4-7(8)9/h2-5,11H,1H3

InChI key: InChIKey=GOYGZCJTYPLCHG-UHFFFAOYSA-N

SMILES: S(C)C=1C=2C(NC1)=CC=C(Cl)C2

Synonyms:

• 5-Chloro-3-(methylthio)-1H-indole
• 1H-Indole, 5-chloro-3-(methylthio)-
• 5-Chloro-3-(methylthio)indole