CymitQuimica logo

CAS 400607-30-9

:

9,9-Diethylfluorene-2-boronicacid

Description:
9,9-Diethylfluorene-2-boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorene structure. This compound typically exhibits properties associated with both the fluorene moiety and the boronic acid group. The fluorene structure contributes to its stability and potential applications in organic electronics, while the boronic acid functionality allows for reversible bonding with diols, making it useful in various chemical reactions, including Suzuki coupling reactions. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents. Its reactivity is influenced by the boron atom, which can participate in coordination chemistry and serve as a building block in the synthesis of more complex organic molecules. Additionally, due to the presence of the diethyl substituents, the compound may exhibit altered electronic properties compared to its unsubstituted counterparts, potentially enhancing its utility in materials science and organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C17H19BO2
InChI:InChI=1/C17H19BO2/c1-3-17(4-2)15-8-6-5-7-13(15)14-10-9-12(18(19)20)11-16(14)17/h5-11,19-20H,3-4H2,1-2H3
SMILES:CCC1(CC)c2ccccc2c2ccc(cc12)B(O)O
Synonyms:
  • (9,9-Diethyl-9H-fluoren-2-yl)boronic acid
  • boronic acid, B-(9,9-diethyl-9H-fluoren-2-yl)-
  • 9,9-Diethylfluorene-2-boronic acid
  • Boronicacid,(9,9-diethyl-9H-fluoren-2-yl)
  • 9,9-Diethylfluorene-2-boronicacid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.