CAS 400607-31-0
:B-(9,9-Diphenyl-9H-fluoren-2-yl)boronic acid
Description:
B-(9,9-Diphenyl-9H-fluoren-2-yl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a fluorenyl moiety. This compound typically exhibits properties such as being a white to off-white solid, with solubility in polar organic solvents like methanol and ethanol, while being less soluble in non-polar solvents. The boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and materials science. Its structure features a central boron atom bonded to a hydroxyl group and an aromatic system, which contributes to its stability and reactivity. Additionally, this compound may exhibit interesting photophysical properties, making it suitable for applications in organic electronics and photonic devices. Safety data should be consulted for handling, as boronic acids can be irritants. Overall, B-(9,9-Diphenyl-9H-fluoren-2-yl)boronic acid is a versatile compound with significant utility in synthetic chemistry and materials development.
Formula:C25H19BO2
InChI:InChI=1S/C25H19BO2/c27-26(28)20-15-16-22-21-13-7-8-14-23(21)25(24(22)17-20,18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-17,27-28H
InChI key:InChIKey=CPFALCJMNUHBHP-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C2C(C=3C(C2=CC1)=CC=CC3)(C4=CC=CC=C4)C5=CC=CC=C5
Synonyms:- 9,9-Diphenylfluoren-2-ylboronic acid
- 9,9-diphenyl-9H-fluorene-2-ylboronicacid
- B-(9,9-Diphenyl-9H-fluoren-2-yl)boronic acid
- Boronic acid, (9,9-diphenyl-9H-fluoren-2-yl)-
- Boronic acid, B-(9,9-diphenyl-9H-fluoren-2-yl)-
- (9,9-Diphenyl-9H-fluoren-2-yl)boronic acid
- 9,9-Diphenylfluorene-2-boronic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(9,9-Diphenyl-9H-fluoren-2-yl)boronic acid
CAS:Formula:C25H19BO2Purity:97%Color and Shape:SolidMolecular weight:362.22829,9-Diphenylfluorene-2-Boronic Acid
CAS:9,9-Diphenylfluorene-2-Boronic AcidFormula:C25H19BO2Purity:>98%Molecular weight:362.239,9-Diphenylfluorene-2-boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C25H19BO2Purity:97.0 to 106.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:362.24(9,9-Diphenyl-9H-fluoren-2-yl)boronic acid
CAS:(9,9-Diphenyl-9H-fluoren-2-yl)boronic acidFormula:C25H19BO2Purity:98%Molecular weight:362.23B-(9,9-Diphenyl-9H-fluoren-2-yl)-boronic Acid-d5
CAS:Controlled ProductFormula:C25D5H14BO2Color and Shape:NeatMolecular weight:367.259B-(9,9-Diphenyl-9H-fluoren-2-yl)-boronic Acid
CAS:Controlled ProductApplications B-(9,9-Diphenyl-9H-fluoren-2-yl)-boronic Acid can be used to synthesize pyrrole/polycyclic aromatic units. It is a potential electroluminescent material.
References Li, C., et al.: J. Org. Chem., 75, 4004 (2010)Formula:C25H19BO2Color and Shape:NeatMolecular weight:362.228





