CAS 40073-83-4

2-Furan-3,4,5-d3-carboxylicacid

Description:

2-Furan-3,4,5-d3-carboxylic acid, with the CAS number 40073-83-4, is a deuterated derivative of furan-3-carboxylic acid. This compound features a furan ring, which is a five-membered aromatic heterocycle containing one oxygen atom. The presence of deuterium (d3) indicates that three hydrogen atoms in the molecule are replaced with deuterium isotopes, which can be useful in various applications, including NMR spectroscopy and tracing studies in metabolic pathways. The carboxylic acid functional group (-COOH) contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The unique isotopic labeling can enhance the understanding of reaction mechanisms and molecular interactions. Additionally, the compound may exhibit specific solubility characteristics and reactivity profiles due to the presence of the furan ring and the carboxylic acid group, making it relevant in organic synthesis and medicinal chemistry. Overall, 2-Furan-3,4,5-d3-carboxylic acid serves as a valuable tool in both research and industrial applications.

Formula: C₅HD₃O₃

InChI: InChI=1S/C5H4O3/c6-5(7)4-2-1-3-8-4/h1-3H,(H,6,7)/i1D,2D,3D

InChI key: SMNDYUVBFMFKNZ-CBYSEHNBSA-N

SMILES: [2H]C1=C(OC(=C1[2H])C(=O)O)[2H]

Synonyms:

• 3,4,5-Trideuterio-2-furancarboxylicacid

2-Furoic-d3 Acid

CAS: 40073-83-4, 88-14-2

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 115.10

Ref: 3U-D5791

2-Furoic Acid-D3

CAS: 40073-83-4

2-Furoic Acid-d3 is a deuterated compound of 2-Furoic Acid.

Formula: C₅H₁D₃O₃

Color and Shape: Solid

Molecular weight: 115.1

Ref: TM-TMIH-0036

2-Furoic Acid-d3

Controlled Product

CAS: 40073-83-4

Applications 2-Furoic Acid-d3 is the labeled analogue of 2-Furoic Acid (F863775), a heterocyclic carboxylic acid that is widely used in food products as a preservative and flavouring agent.
References Hall, I.H., et al.: Arch, Pharm., 326, 15 (1993)

Formula: C₅D₃HO₃

Color and Shape: Neat

Molecular weight: 115.1019

Ref: TR-F863777

2-Furoic-d3 Acid

CAS: 40073-83-4

Formula: C₅H₄O₃

Molecular weight: 115.1

Ref: BE-MD-6310