CymitQuimica logo

CAS 400840-94-0

:

ethyl 1-(aminomethyl)cyclopropanecarboxylate

Description:
Ethyl 1-(aminomethyl)cyclopropanecarboxylate is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an ethyl ester functional group. This compound features an aminomethyl substituent, which introduces an amine group into the cyclopropane framework, potentially influencing its reactivity and biological activity. The presence of the ethyl ester suggests that it may participate in esterification reactions and could be hydrolyzed to release the corresponding carboxylic acid and alcohol. The cyclopropane moiety often imparts strain, which can lead to increased reactivity compared to more stable cyclic structures. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as compounds containing cyclopropane rings are often explored for their biological activities. Additionally, the amine group may facilitate interactions with biological targets, making it a candidate for further research in drug development. Overall, ethyl 1-(aminomethyl)cyclopropanecarboxylate presents a fascinating structure with potential applications in various chemical and pharmaceutical fields.
Formula:C7H13NO2
InChI:InChI=1/C7H13NO2/c1-2-10-6(9)7(5-8)3-4-7/h2-5,8H2,1H3
InChI key:AYTOKAZVIPSHHI-UHFFFAOYSA-N
SMILES:CCOC(=O)C1(CC1)CN
Synonyms:
  • 1-(Aminomethyl)-cyclopropanecarboxylic acid ethyl ester
  • Cyclopropanecarboxylic Acid, 1-(Aminomethyl)-, Ethyl Ester
Found 4 products.