CAS 400882-07-7: Cyflumetofen
Description:Cyflumetofen is a chemical compound classified as a pesticide, specifically an acaricide, used primarily for the control of mites in agricultural settings. It belongs to the class of compounds known as benzoylureas, which function by disrupting the growth and development of target pests. Cyflumetofen exhibits a unique mode of action that interferes with the synthesis of chitin, a critical component of the exoskeleton in arthropods, leading to their eventual death. The substance is characterized by its relatively low toxicity to non-target organisms, including beneficial insects and mammals, making it a more environmentally friendly option compared to traditional pesticides. It is typically applied in various formulations, including emulsifiable concentrates and granules, and is effective against a wide range of mite species. Additionally, Cyflumetofen has a favorable environmental profile, with low persistence in soil and water, reducing the risk of contamination and accumulation in ecosystems. As with all pesticides, proper handling and application according to regulatory guidelines are essential to ensure safety and efficacy.
Formula:C24H24F3NO4
InChI:InChI=1S/C24H24F3NO4/c1-22(2,3)16-9-11-17(12-10-16)23(15-28,21(30)32-14-13-31-4)20(29)18-7-5-6-8-19(18)24(25,26)27/h5-12H,13-14H2,1-4H3
InChI key:InChIKey=AWSZRJQNBMEZOI-UHFFFAOYSA-N
SMILES:N#CC(C(=O)OCCOC)(C(=O)C=1C=CC=CC1C(F)(F)F)C2=CC=C(C=C2)C(C)(C)C
- Synonyms:
- 2-methoxyethyl (RS)-2-(4-tert-butylphenyl)-2-cyano-3-oxo-3-(alpha,alpha,alpha-trifluoro-o-tolyl)propionate
- Bas 92100I
- Benzenepropanoic acid, α-cyano-α-[4-(1,1-dimethylethyl)phenyl]-β-oxo-2-(trifluoromethyl)-, 2-methoxyethyl ester
- Cyflumetofen
- alpha-Cyano-alpha-[4-(1,1-dimethylethyl)phenyl]-beta-oxo-2-(trifluoromethyl)benzenepropanoic acid 2-methoxyethyl ester
