CAS 402-13-1
:2-Amino-4-(trifluoromethyl)benzoic acid
Description:
2-Amino-4-(trifluoromethyl)benzoic acid, with the CAS number 402-13-1, is an aromatic amino acid derivative characterized by the presence of an amino group (-NH2) and a trifluoromethyl group (-CF3) attached to a benzoic acid structure. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, owing to its carboxylic acid functional group. The trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The compound exhibits acidic properties due to the carboxylic acid moiety, allowing it to participate in various chemical reactions, including esterification and amidation. Additionally, the presence of the amino group can facilitate interactions with biological targets, potentially leading to applications in drug development. Safety data should be consulted, as the trifluoromethyl group can impart unique toxicological properties. Overall, 2-Amino-4-(trifluoromethyl)benzoic acid is a versatile compound with significant implications in both synthetic chemistry and medicinal applications.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c9-8(10,11)4-1-2-5(7(13)14)6(12)3-4/h1-3H,12H2,(H,13,14)
InChI key:InChIKey=NQTLZJODEOHALT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(N)=C(C(O)=O)C=C1
Synonyms:- 2-Amino-4-(Trifluoromethyl)Benzoate
- 2-Amino-4-trifluoromethylbenzoic acid
- 2-Nitro-5-(Trifluoromethyl)Aniline
- 4-(Trifluoromethyl)anthranilic acid
- 4-Trifluoromethylanthranilic acid
- Benzoic acid, 2-amino-4-(trifluoromethyl)-
- p-Toluic acid, 2-amino-α,α,α-trifluoro-
- 2-Amino-4-(trifluoromethyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-AMINO-4-(TRIFLUOROMETHYL)BENZOIC ACID
CAS:Formula:C8H6F3NO2Purity:98%Color and Shape:SolidMolecular weight:205.13392-Amino-4-(trifluoromethyl)benzoic acid
CAS:2-Amino-4-(trifluoromethyl)benzoic acidFormula:C8H6F3NO2Purity:98%Color and Shape: off white powderMolecular weight:205.13g/mol2-Amino-4-(trifluoromethyl)benzoic Acid
CAS:Formula:C8H6F3NO2Purity:>97.0%(T)(HPLC)Color and Shape:White to Amber powder to crystallineMolecular weight:205.142-Amino-4-(trifluoromethyl)benzoic acid
CAS:2-Amino-4-(trifluoromethyl)benzoic acid (2ATB) is a fluorescent compound that is used in assays to study the function of cells. It is a functional theory that 2ATB binds to the skeleton of cells, which are then subjected to optical properties testing. Fluorescence resonance energy transfer has been shown to occur between 2ATB and retinoic acid molecules in the cell nucleus, which may be related to cellular senescence. The structure of 2ATB has been determined by X-ray crystallography and it has been synthesized by halogenation.
Formula:C8H6F3NO2Purity:Min. 95%Color and Shape:PowderMolecular weight:205.13 g/mol2-Amino-4-trifluoromethylbenzoic acid
CAS:Formula:C8H6F3NO2Purity:97%Color and Shape:SolidMolecular weight:205.136





