CymitQuimica logo

CAS 402-50-6

:

4-(trifluoromethyl)styrene

Description:
4-(Trifluoromethyl)styrene is an organic compound characterized by the presence of a styrene backbone with a trifluoromethyl group (-CF3) attached to the para position of the phenyl ring. This compound is a colorless to pale yellow liquid at room temperature and is known for its distinctive aromatic odor. It is relatively non-polar due to the presence of the trifluoromethyl group, which enhances its lipophilicity and can influence its reactivity and solubility in organic solvents. The trifluoromethyl group also imparts unique electronic properties, making 4-(trifluoromethyl)styrene a valuable building block in organic synthesis and materials science. It can undergo various chemical reactions, including polymerization, where it can be used to create fluorinated polymers with desirable thermal and chemical resistance. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 4-(trifluoromethyl)styrene is significant in the development of advanced materials and specialty chemicals.
Formula:C9H7F3
InChI:InChI=1S/C9H7F3/c1-2-7-3-5-8(6-4-7)9(10,11)12/h2-6H,1H2
InChI key:CEWDRCQPGANDRS-UHFFFAOYSA-N
SMILES:C=CC1=CC=C(C=C1)C(F)(F)F
Found 6 products.