CAS 402571-34-0
:1-O-Dodecylglycerol
Description:
1-O-Dodecylglycerol is a chemical compound characterized by its long hydrophobic dodecyl (C12) alkyl chain attached to a glycerol backbone. This structure imparts both hydrophilic and hydrophobic properties, making it an amphiphilic molecule. It typically appears as a colorless to pale yellow liquid or solid, depending on the temperature. The compound is soluble in organic solvents and exhibits limited solubility in water due to its long hydrocarbon chain. 1-O-Dodecylglycerol is often used in various applications, including as a surfactant, emulsifier, or stabilizer in formulations, particularly in the cosmetic and pharmaceutical industries. Its unique properties allow it to enhance the solubility of hydrophobic compounds and improve the stability of emulsions. Additionally, it may have potential applications in drug delivery systems and as a model compound for studying membrane interactions. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H32O3
InChI:InChI=1S/C15H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-18-14-15(17)13-16/h15-17H,2-14H2,1H3
InChI key:InChIKey=GBXRUYNQDDTQQS-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCC)OCC(CO)O
Synonyms:- Glycerol 1-lauryl ether
- Lauryl glyceryl ether
- 1,2-Propanediol, 3-(dodecyloxy)-
- 3-(Dodecyloxy)-1,2-propanediol
- 1-O-Dodecylglycerol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-O-Dodecyl-rac-glycerol-d5
CAS:Controlled ProductApplications 1-O-Dodecyl-rac-glycerol-d5 is labelled 1-O-Dodecylglycerol (D525520) which is a antibacterial agent which stimulates autolysin activity in Streptococcus faecium ATCC 9790. It is also found to be synergistic with amphotericin B against fungi.
References Ved, H., et al.: J. Biol. Chem., 259, 8115 (1984); Haynes, M., et al.: Antimicro. Agents Chemother., 38, 1523 (1994)Formula:C15D5H27O3Color and Shape:NeatMolecular weight:265.444
