CymitQuimica logo

CAS 40274-29-1

:

Benzene, 1-(3-bromo-1-propynyl)-4-fluoro-

Description:
Benzene, 1-(3-bromo-1-propynyl)-4-fluoro-, also known by its CAS number 40274-29-1, is an organic compound characterized by a benzene ring substituted with a bromopropynyl group and a fluorine atom. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity, while the fluorine atom enhances its electronegativity and can affect its interaction with other molecules. This compound is likely to exhibit properties typical of aromatic compounds, such as stability due to resonance, and may participate in electrophilic substitution reactions. The alkyne functional group (from the propynyl moiety) can also engage in various chemical reactions, including addition reactions. Its unique structure may impart specific biological or chemical activities, making it of interest in fields such as medicinal chemistry or materials science. Safety data and handling precautions should be considered, as halogenated compounds can pose health risks. Overall, this compound exemplifies the complexity and versatility of substituted aromatic compounds in organic chemistry.
Formula:C9H6BrF
InChI:InChI=1S/C9H6BrF/c10-7-1-2-8-3-5-9(11)6-4-8/h3-6H,7H2
InChI key:PUSYURWHOHXATJ-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C#CCBr)F
Found 4 products.