CAS 402788-68-5

4,4,5,5-tetradeuterio-2-methoxy-1H-imidazole

Description:

4,4,5,5-Tetradeuterio-2-methoxy-1H-imidazole is a deuterated derivative of imidazole, a five-membered aromatic heterocyclic compound containing two nitrogen atoms. The presence of deuterium, a stable isotope of hydrogen, in the 4 and 5 positions enhances the compound's stability and alters its physical properties, such as boiling and melting points, compared to its non-deuterated counterpart. This compound is characterized by its methoxy group at the 2-position, which contributes to its solubility and reactivity. Imidazole derivatives are known for their biological activity, often serving as building blocks in pharmaceuticals and agrochemicals. The specific isotopic labeling can be useful in various applications, including NMR spectroscopy, where it aids in the study of molecular dynamics and interactions. Additionally, the unique properties of deuterated compounds can enhance the understanding of reaction mechanisms and pathways in chemical research. Overall, 4,4,5,5-tetradeuterio-2-methoxy-1H-imidazole serves as a valuable tool in both synthetic and analytical chemistry.

Formula: C₄H₄D₄N₂O

InChI: InChI=1/C4H8N2O/c1-7-4-5-2-3-6-4/h2-3H2,1H3,(H,5,6)/i2D2,3D2

SMILES: COC1=NC(C(N1)([2H])[2H])([2H])[2H]

Synonyms:

• 1H-imidazole-4,5-d2
• 2-Methoxy(4,4,5,5-2

2-Methoxy-4,5-dihydro-1H-imidazole-4,4,5,5-d4"Carboglace"

CAS: 28118-54-9, 402788-68-5

Purity: 99 atom % D

Color and Shape: White Solid

Molecular weight: 104.14

Ref: 3U-D6120