CymitQuimica logo

CAS 4029-26-9

:

2,2-dimethyl-4-oxo-cyclohexanecarboxylic acid

Description:
2,2-Dimethyl-4-oxo-cyclohexanecarboxylic acid, with the CAS number 4029-26-9, is an organic compound characterized by its cyclohexane ring structure, which is substituted with two methyl groups and a carboxylic acid functional group. This compound features a ketone group (the 4-oxo designation) that contributes to its reactivity and potential applications in organic synthesis. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The dimethyl substitution can influence the compound's steric hindrance and solubility, affecting its behavior in different solvents. Typically, compounds like this may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as intermediates in organic chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2,2-dimethyl-4-oxo-cyclohexanecarboxylic acid is a versatile compound with potential applications in various chemical fields.
Formula:C9H14O3
InChI:InChI=1/C9H14O3/c1-9(2)5-6(10)3-4-7(9)8(11)12/h7H,3-5H2,1-2H3,(H,11,12)
InChI key:NZSQDCPBCNZMHB-UHFFFAOYSA-N
SMILES:CC1(C)CC(=O)CCC1C(=O)O
Synonyms:
  • Cyclohexanecarboxylic Acid, 2,2-Dimethyl-4-Oxo-
Found 5 products.