CymitQuimica logo

CAS 402936-15-6

:

Boronic acid, 2-dibenzofuranyl-

Description:
Boronic acid, 2-dibenzofuranyl- (CAS 402936-15-6) is an organoboron compound characterized by the presence of a boronic acid functional group (-B(OH)2) attached to a dibenzofuranyl moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications including organic synthesis and medicinal chemistry. The dibenzofuranyl group contributes to its aromatic character and may influence its solubility and reactivity. Boronic acids are known for their role in Suzuki coupling reactions, which are vital for forming carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, the presence of the dibenzofuranyl structure may impart specific electronic and steric properties, affecting the compound's reactivity and interaction with biological targets. Overall, this compound is of interest in both synthetic organic chemistry and potential pharmaceutical applications due to its unique structural features and functional capabilities.
Formula:C12H9BO3
InChI:InChI=1S/C12H9BO3/c14-13(15)8-5-6-12-10(7-8)9-3-1-2-4-11(9)16-12/h1-7,14-15H
InChI key:DSSBJZCMMKRJTF-UHFFFAOYSA-N
SMILES:B(C1=CC2=C(C=C1)OC3=CC=CC=C32)(O)O
Synonyms:
  • Dibenzofuran-2-boronic acid
  • 2-Dibenzofuranyl-boronic acid
  • Dibenzo[b,d]furan-2-ylboronic acid
Found 5 products.