CymitQuimica logo

CAS 40298-25-7

:

N-Me-Phe-OBzl . p-tosylate

Description:
N-Me-Phe-OBzl·p-tosylate, with the CAS number 40298-25-7, is a chemical compound that features a benzyl ester of a phenylalanine derivative, where the nitrogen is methylated (N-Me) and the phenylalanine is protected by a benzyl group (OBzl). The presence of the p-tosylate indicates that the compound is a salt formed with p-toluenesulfonic acid, which enhances its solubility and stability in various solvents. This compound is typically used in organic synthesis, particularly in peptide chemistry, as it can serve as a building block or intermediate in the formation of more complex molecules. Its characteristics include a relatively high molecular weight due to the presence of aromatic groups, which contribute to its hydrophobic nature. The p-tosylate moiety also provides a good leaving group in nucleophilic substitution reactions, making it useful in various synthetic applications. Overall, N-Me-Phe-OBzl·p-tosylate is valued for its reactivity and versatility in chemical synthesis.
Formula:C17HNO2·C7H8O3S
InChI:InChI=1S/C17H19NO2.C7H8O3S/c1-18-16(12-14-8-4-2-5-9-14)17(19)20-13-15-10-6-3-7-11-15;1-6-2-4-7(5-3-6)11(8,9)10/h2-11,16,18H,12-13H2,1H3;2-5H,1H3,(H,8,9,10)/t16-;/m0./s1
InChI key:TUDJZSODAYRPLC-NTISSMGPSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)O.CN[C@@H](CC1=CC=CC=C1)C(=O)OCC2=CC=CC=C2
Synonyms:
  • N-Me-Phe-Obzl P-Tosylate
Found 3 products.