CAS 403-14-5
:3'-Fluoro-4'-hydroxyacetophenone
Description:
3'-Fluoro-4'-hydroxyacetophenone, with the CAS number 403-14-5, is an organic compound that belongs to the class of acetophenones. This compound features a fluorine atom at the 3' position and a hydroxyl group at the 4' position of the aromatic ring, which contributes to its unique chemical properties. It typically appears as a solid and is characterized by its moderate solubility in organic solvents, while being less soluble in water due to its hydrophobic acetophenone structure. The presence of the hydroxyl group imparts some polar characteristics, allowing for potential hydrogen bonding interactions. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential as an intermediate in the synthesis of more complex molecules. Its reactivity can be influenced by the electron-withdrawing nature of the fluorine atom, which can affect the compound's behavior in chemical reactions. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H7FO2
InChI:InChI=1/C8H7FO2/c1-5(10)6-2-3-8(11)7(9)4-6/h2-4,11H,1H3
SMILES:CC(=O)c1ccc(c(c1)F)O
Synonyms:- 1-(3-Fluoro-4-hydroxyphenyl)ethanone
- Ethanone, 1-(3-fluoro-4-hydroxyphenyl)-
- 3-Fluoro-4-hydroxyacetophenone
- 3'-fluoro-4'-nitroacetophenone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3'-Fluoro-4'-hydroxyacetophenone
CAS:Formula:C8H7FO2Purity:>97.0%(GC)(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:154.143'-Fluoro-4'-hydroxyacetophenone
CAS:3'-Fluoro-4'-hydroxyacetophenoneFormula:C8H7FO2Purity:98%Molecular weight:154.143'-Fluoro-4'-hydroxyacetophenone
CAS:3'-Fluoro-4'-hydroxyacetophenoneFormula:C8H7FO2Purity:≥95%Color and Shape:White SolidMolecular weight:154.138383'-Fluoro-4'-hydroxyacetophenone
CAS:Formula:C8H7FO2Purity:98%Color and Shape:SolidMolecular weight:154.13843′-Fluoro-4′-hydroxyacetophenone
CAS:Formula:C8H7FO2Purity:96%Color and Shape:SolidMolecular weight:154.143'-Fluoro-4'-hydroxyacetophenone
CAS:3'-Fluoro-4'-hydroxyacetophenone is a fluorinated acetophenone that is synthesized by catalytic hydrogenation of 3,4-difluoroacetophenone. This reaction produces the desired product in high yield. The product can be used in the synthesis of various pharmaceuticals, such as analgesics, antihistamines and antidiabetic agents. 3'-Fluoro-4'-hydroxyacetophenone has been shown to have higher yields and better solubility than its counterparts. It also has a high boiling point, making it suitable for industrial use.Formula:C8H7FO2Purity:Min. 95%Color and Shape:PowderMolecular weight:154.14 g/mol





