CAS 403-16-7
:3-Chloro-4-fluorobenzoic acid
Description:
3-Chloro-4-fluorobenzoic acid is an aromatic carboxylic acid characterized by the presence of both chlorine and fluorine substituents on the benzene ring. Specifically, the chlorine atom is located at the meta position (3-position) and the fluorine atom at the para position (4-position) relative to the carboxylic acid group. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. It exhibits acidic properties, with the carboxylic acid group capable of donating a proton in solution. The presence of electronegative halogen atoms influences its reactivity, making it useful in various chemical syntheses, including the production of pharmaceuticals and agrochemicals. Additionally, 3-chloro-4-fluorobenzoic acid can participate in electrophilic aromatic substitution reactions, and its unique substituent pattern can affect the electronic properties and steric hindrance of the molecule, impacting its behavior in chemical reactions.
Formula:C7H4ClFO2
InChI:InChI=1S/C7H4ClFO2/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3H,(H,10,11)
InChI key:InChIKey=PKTSBFXIHLYGEY-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(Cl)=C(F)C=C1
Synonyms:- 3-Chloro-4-Fluorobenzoate
- 4-Fluoro-3-Chlorobenzoicacid
- 5-Chloro-4-difluorobenzoic acid
- Benzoic acid, 3-chloro-4-fluoro-
- Qvr Cg Df
- 3-Chloro-4-fluorobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Chloro-4-fluorobenzoic Acid
CAS:Formula:C7H4ClFO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:174.563-Chloro-4-Fluorobenzoic Acid
CAS:Formula:C7H4ClFO2Purity:98%Color and Shape:SolidMolecular weight:174.55693-Chloro-4-fluorobenzoic acid
CAS:3-Chloro-4-fluorobenzoic acidFormula:C7H4ClFO2Purity:98%Color and Shape:SolidMolecular weight:174.56g/mol3-Chloro-4-fluorobenzoic acid
CAS:3-Chloro-4-fluorobenzoic acid is a prodrug that is converted to fluvoxamine maleate, its active form, by esterases. It is an inhibitor of the enzyme nitric oxide synthase and is used in the treatment of cancer. 3-Chloro-4-fluorobenzoic acid has been shown to inhibit cellular growth and proliferation in cancer cells. The molecular modeling study showed that 3-chloro-4-fluorobenzoic acid binds to the kinesin motor domain in a manner similar to fluvoxamine maleate but has a lower inhibitory potency than fluvoxamine maleate. Nonetheless, it was found that 3-chloro-4-fluorobenzoic acid could be used as a prodrug for fluvoxamine maleate.Formula:C7H4ClFO2Purity:Min. 95%Color and Shape:PowderMolecular weight:174.56 g/mol3-Chloro-4-fluorobenzoic acid
CAS:Formula:C7H4ClFO2Purity:95%Color and Shape:SolidMolecular weight:174.56






