CymitQuimica logo

CAS 403-25-8

:

1-(Difluoromethyl)-3-nitrobenzene

Description:
1-(Difluoromethyl)-3-nitrobenzene, with the CAS number 403-25-8, is an organic compound characterized by the presence of a nitro group (-NO2) and a difluoromethyl group (-CF2H) attached to a benzene ring. This compound typically appears as a pale yellow to light brown liquid or solid, depending on its physical state at room temperature. It is known for its aromatic properties, which contribute to its stability and reactivity. The difluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The nitro group can participate in electrophilic aromatic substitution reactions, allowing for further functionalization of the benzene ring. Additionally, 1-(Difluoromethyl)-3-nitrobenzene may exhibit specific toxicological properties, necessitating careful handling and storage. Its unique structure and functional groups make it a valuable compound for research and industrial applications, particularly in the synthesis of more complex organic molecules.
Formula:C7H5F2NO2
InChI:InChI=1S/C7H5F2NO2/c8-7(9)5-2-1-3-6(4-5)10(11)12/h1-4,7H
InChI key:InChIKey=QOGPXSPKXMNSLH-UHFFFAOYSA-N
SMILES:C(F)(F)C1=CC(N(=O)=O)=CC=C1
Synonyms:
  • α,α-Difluoro-3-nitrotoluene
  • Benzene, 1-(difluoromethyl)-3-nitro-
  • Toluene, α,α-difluoro-m-nitro-
  • 1-(Difluoromethyl)-3-nitrobenzene
Found 3 products.