CAS 40400-15-5
:2-Iodophenylacetonitrile
Description:
2-Iodophenylacetonitrile, with the CAS number 40400-15-5, is an organic compound characterized by the presence of both an iodine atom and a nitrile functional group. It features a phenyl ring substituted with an iodine atom at the second position and an acetonitrile group, which consists of a carbon atom triple-bonded to a nitrogen atom. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its utility in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. The presence of the iodine atom can enhance its reactivity, making it a valuable intermediate in nucleophilic substitution reactions. Additionally, the nitrile group contributes to its polar nature, influencing its solubility in organic solvents. Safety considerations should be taken into account when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 2-Iodophenylacetonitrile is a significant compound in synthetic organic chemistry with diverse applications.
Formula:C8H6IN
InChI:InChI=1/C8H6IN/c9-8-4-2-1-3-7(8)5-6-10/h1-4H,5H2
SMILES:c1ccc(c(c1)CC#N)I
Synonyms:- 2-Iodobenzyl cyanide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Iodophenylacetonitrile, 96%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H6INPurity:96%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:243.052-(2-Iodophenyl)Acetonitrile
CAS:2-(2-Iodophenyl)AcetonitrileFormula:C8H6INPurity:97%Molecular weight:243.042-(2-Iodophenyl)acetonitrile
CAS:Formula:C8H6INPurity:96%Color and Shape:SolidMolecular weight:243.0444



