CymitQuimica logo

CAS 40421-52-1

:

(1S,2R)-1-phenylpropane-1,2-diol

Description:
(1S,2R)-1-phenylpropane-1,2-diol, also known as phenylpropanediol, is an organic compound characterized by its chiral structure, featuring two stereocenters. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It possesses hydroxyl (-OH) functional groups, which contribute to its solubility in polar solvents and its ability to engage in hydrogen bonding. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its reactivity and interactions with other molecules. This compound is often studied for its applications in pharmaceuticals, cosmetics, and as a potential building block in organic synthesis. Its stereochemistry is significant, as the specific configuration can affect biological activity and interactions. Additionally, (1S,2R)-1-phenylpropane-1,2-diol may exhibit properties such as low volatility and moderate viscosity, making it suitable for various formulations. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H12O2
InChI:InChI=1/C9H12O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9-11H,1H3/t7-,9-/m1/s1
InChI key:MZQZXSHFWDHNOW-CBAPKCEASA-N
SMILES:C[C@H]([C@H](c1ccccc1)O)O
Synonyms:
  • 1,2-propanediol, 1-phenyl-, (1S,2R)-
Found 4 products.