CymitQuimica logo

CAS 40423-36-7

:

9H-Purine, 6-chloro-2,9-dimethyl-

Description:
9H-Purine, 6-chloro-2,9-dimethyl- is a chemical compound belonging to the purine class, which is characterized by a bicyclic structure composed of fused imidazole and pyrimidine rings. This specific compound features a chlorine atom at the 6-position and two methyl groups at the 2 and 9 positions of the purine ring. The presence of these substituents can influence its biological activity and solubility. Purines are essential components of nucleic acids, playing critical roles in cellular processes such as energy transfer (as in ATP) and signal transduction. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its CAS number, 40423-36-7, allows for precise identification in chemical databases. As with many purine derivatives, it may also be involved in interactions with enzymes or receptors, potentially leading to therapeutic applications or biological research insights. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C7H7ClN4
InChI:InChI=1S/C7H7ClN4/c1-4-10-6(8)5-7(11-4)12(2)3-9-5/h3H,1-2H3
InChI key:SKTPMBONYIWPAC-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C(=N1)Cl)N=CN2C
Found 3 products.