CAS 40437-72-7

KAEMPFEROL-3-O-GLUCORHAMNOSIDE

Description:

Kaempferol-3-O-glucorhamnoside is a flavonoid glycoside, a type of plant secondary metabolite known for its potential health benefits. This compound consists of a kaempferol aglycone linked to a glucorhamnose sugar moiety, which enhances its solubility and bioavailability. It is typically found in various plants, particularly in fruits, vegetables, and herbs, contributing to their antioxidant properties. Kaempferol itself is recognized for its anti-inflammatory, anticancer, and cardioprotective effects, and the glycosylation in kaempferol-3-O-glucorhamnoside may influence its biological activity and stability. The compound is often studied for its role in traditional medicine and its potential applications in nutraceuticals. Its CAS number, 40437-72-7, allows for precise identification in chemical databases and research. Overall, kaempferol-3-O-glucorhamnoside exemplifies the complex interplay between plant chemistry and health, highlighting the importance of phytochemicals in diet and wellness.

Formula: C₂₇H₃₀O₁₅

InChI: InChI=1S/C27H30O15/c1-9-17(32)20(35)22(37)26(38-9)42-25-21(36)18(33)15(8-28)40-27(25)41-24-19(34)16-13(31)6-12(30)7-14(16)39-23(24)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-22,25-33,35-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22-,25-,26+,27+/m1/s1

InChI key: OHOBPOYHROOXEI-OVNVQJKQSA-N

SMILES: C[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@@H]([C@H]([C@@H](O[C@H]2OC3=C(OC4=CC(=CC(=C4C3=O)O)O)C5=CC=C(C=C5)O)CO)O)O)O)O)O

Synonyms:

• Kaempeerol-3-Oglucorhamnoside
• Kaempferol 3-glucorhamnoside
• Kaempferol-3-O-glucuronid
• 3-[(6-Deoxy-O-beta-D-glucopyranosyl-alpha-L-mannopyranosyl)oxy]-5,7-dihydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one

Kaempferol-3-O-glucorhamnoside

CAS: 40437-72-7

Kaempferol-3-O-glucorhamnoside

Formula: C₂₇H₃₀O₁₅

Purity: ≥95%

Molecular weight: 594.5

Ref: 54-BUP08917

Kaempferol 3-O-neohesperidoside

CAS: 40437-72-7

Formula: C₂₇H₃₀O₁₅

Purity: 95%~99%

Molecular weight: 594.522

Ref: BP-BPF0697

Kaempferol-3-glucorhamnoside

CAS: 40437-72-7

Formula: C₂₇H₃₀O₁₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 594.5181

Ref: IN-DA00C5PH

Kaempferol-3-O-glucorhamnoside

CAS: 40437-72-7

Kaempferol-3-O-glucorhamnoside (Kaempferol 3-glucorhamnoside), a flavonoid derived from plant Thesium chinense Turcz, inhibits inflammatory responses via MAPK

Formula: C₂₇H₃₀O₁₅

Purity: 96.96% - 98.17%

Color and Shape: Solid

Molecular weight: 594.5181

Ref: TM-T5S0089

Kaempferol-3-O-glucorhamnoside

CAS: 40437-72-7

Kaempferol-3-O-glucorhamnoside is a bioactive flavonoid glycoside, which is a naturally occurring compound found in a variety of plants. It serves as a significant molecule in the study of plant biochemistry and pharmacology. This compound is sourced from various plant species such as tea, broccoli, and other common vegetables and fruits, where it contributes to the plant's defense mechanisms against environmental stresses.

Formula: C₂₇H₃₀O₁₅

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 594.52 g/mol

Ref: 3D-FK66099