CymitQuimica logo

CAS 40456-50-6

:

Yatein

Description:
Yatein, with the CAS number 40456-50-6, is a chemical compound that belongs to the class of natural products. It is primarily known for its occurrence in certain plant species, where it may play a role in various biological activities. The compound is characterized by its unique molecular structure, which contributes to its potential pharmacological properties. Yatein has been studied for its effects on various biological systems, including its potential anti-inflammatory and antioxidant activities. Additionally, it may exhibit interactions with specific biological targets, making it of interest in medicinal chemistry and drug development. However, detailed information regarding its physical and chemical properties, such as solubility, melting point, and specific reactivity, may require further investigation through experimental studies or literature reviews. As research continues, the understanding of Yatein's characteristics and applications may expand, highlighting its significance in both natural product chemistry and potential therapeutic uses.
Formula:C22H24O7
InChI:InChI=1S/C22H24O7/c1-24-19-9-14(10-20(25-2)21(19)26-3)7-16-15(11-27-22(16)23)6-13-4-5-17-18(8-13)29-12-28-17/h4-5,8-10,15-16H,6-7,11-12H2,1-3H3/t15-,16+/m0/s1
InChI key:InChIKey=GMLDZDDTZKXJLU-JKSUJKDBSA-N
SMILES:C([C@@H]1[C@@H](CC=2C=C3C(=CC2)OCO3)COC1=O)C4=CC(OC)=C(OC)C(OC)=C4
Synonyms:
  • (-)-Yatein
  • (-)-trans-3-(3,4-Methylenedioxybenzyl)-2-(3,4,5-trimethoxybenzyl)butyrolactone
  • (3R,4R)-4-(1,3-Benzodioxol-5-ylmethyl)dihydro-3-[(3,4,5-trimethoxyphenyl)methyl]-2(3H)-furanone
  • 2(3H)-Furanone, 4-(1,3-benzodioxol-5-ylmethyl)dihydro-3-[(3,4,5-trimethoxyphenyl)methyl]-, (3R-trans)-
  • 2(3H)-furanone, 4-(1,3-benzodioxol-5-ylmethyl)dihydro-3-[(3,4,5-trimethoxyphenyl)methyl]-, (3R,4R)-
  • Deoxypodorhizon
  • Deoxypodorhizone
  • Dihydroanhydropodorhizol
  • (3R,4R)-4-(1,3-Benzodioxol-5-ylmethyl)-3-(3,4,5-trimethoxybenzyl)dihydrofuran-2(3H)-one
Found 4 products.