CAS 405060-95-9: (2E)-3-Phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-2-propenamide
Description:The chemical substance known as (2E)-3-Phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-2-propenamide, with CAS number 405060-95-9, is a synthetic organic compound characterized by its complex structure, which includes a propenamide backbone, a phenyl group, and a quinoline moiety. This compound features multiple functional groups, including amine and thioxomethyl groups, which contribute to its potential biological activity. The presence of trichloro groups suggests that it may exhibit unique reactivity and interactions in biological systems. The quinoline structure is often associated with various pharmacological properties, including antimicrobial and anticancer activities. The compound's specific stereochemistry, indicated by the (2E) configuration, plays a crucial role in its biological interactions and efficacy. Overall, this substance is of interest in medicinal chemistry and may be explored for its therapeutic potential, although detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C21H17Cl3N4OS
InChI:InChI=1/C21H17Cl3N4OS/c22-21(23,24)19(27-17(29)12-11-14-6-2-1-3-7-14)28-20(30)26-16-10-4-8-15-9-5-13-25-18(15)16/h1-13,19H,(H,27,29)(H2,26,28,30)/b12-11+
InChI key:InChIKey=LCOIAYJMPKXARU-VAWYXSNFNA-N
SMILES:O=C(C=CC=1C=CC=CC1)NC(NC(=S)NC2=CC=CC3=CC=CN=C32)C(Cl)(Cl)Cl
- Synonyms:
- (2E)-3-Phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-2-propenamide
- (2E)-3-Phenyl-N-{2,2,2-trichloro-1-[(quinolin-8-ylcarbamothioyl)amino]ethyl}acrylamide
- 2-propenamide, 3-phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-, (2E)-
- Salubrinal
![(2E)-3-Phenyl-N-[2,2,2-trichloro-1-[[(8-quinolinylamino)thioxomethyl]amino]ethyl]-2-propenamide](https://static.cymitquimica.com/cas-image/395551-2e-3-phenyl-n-222-trichloro-1-8-quinolinylamino-thioxomethyl-amino-ethyl-2-propenamide.png)
