CymitQuimica logo

CAS 405090-49-5

:

Cyclobutanecarbonitrile, 1-(1,3-benzodioxol-5-yl)-

Description:
Cyclobutanecarbonitrile, 1-(1,3-benzodioxol-5-yl)-, identified by its CAS number 405090-49-5, is an organic compound characterized by a cyclobutane ring and a carbonitrile functional group, along with a benzodioxole moiety. This compound typically exhibits a molecular structure that combines the rigidity of the cyclobutane with the reactivity of the carbonitrile, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The presence of the benzodioxole group may impart additional properties, such as potential biological activity or enhanced solubility in organic solvents. Cyclobutanecarbonitrile derivatives are of interest in synthetic organic chemistry and may serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The compound's physical properties, such as boiling point, melting point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, this compound represents a unique combination of structural features that may lead to diverse applications in chemical research and industry.
Formula:C12H11NO2
InChI:InChI=1S/C12H11NO2/c13-7-12(4-1-5-12)9-2-3-10-11(6-9)15-8-14-10/h2-3,6H,1,4-5,8H2
InChI key:SRMXCMRSQZVCOE-UHFFFAOYSA-N
SMILES:C1CC(C1)(C#N)C2=CC3=C(C=C2)OCO3
Found 3 products.