CymitQuimica logo

CAS 407-91-0

:

6-[(trifluoroacetyl)amino]hexanoic acid

Description:
6-[(Trifluoroacetyl)amino]hexanoic acid, with the CAS number 407-91-0, is an organic compound characterized by its structure, which includes a hexanoic acid backbone with a trifluoroacetylamino group at the sixth carbon position. This compound is typically a white to off-white solid at room temperature and is soluble in polar solvents due to the presence of both hydrophobic and hydrophilic regions in its molecular structure. The trifluoroacetyl group imparts unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions, such as acylation and amidation. It may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. The presence of the trifluoroacetyl moiety can also influence the compound's stability and interaction with biological systems. Safety data should be consulted, as compounds with trifluoroacetyl groups can sometimes pose health hazards. Overall, 6-[(trifluoroacetyl)amino]hexanoic acid is a versatile compound with applications in synthetic chemistry and potential therapeutic uses.
Formula:C8H12F3NO3
InChI:InChI=1/C8H12F3NO3/c9-8(10,11)7(15)12-5-3-1-2-4-6(13)14/h1-5H2,(H,12,15)(H,13,14)
InChI key:FGUZMCXMRNWZPT-UHFFFAOYSA-N
SMILES:C(CCC(=O)O)CCN=C(C(F)(F)F)O
Found 3 products.