CymitQuimica logo

CAS 40757-20-8

:

methyl 4-methoxy-3-nitrobenzoate

Description:
Methyl 4-methoxy-3-nitrobenzoate, with the CAS number 40757-20-8, is an organic compound that belongs to the class of benzoates. It features a benzoate structure with a methoxy group and a nitro group positioned on the aromatic ring. The presence of the methoxy group typically enhances the compound's solubility in organic solvents, while the nitro group can impart specific reactivity and influence the compound's electronic properties. This compound is generally characterized by its moderate polarity, which allows it to participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Methyl 4-methoxy-3-nitrobenzoate may also exhibit biological activity, making it of interest in medicinal chemistry and synthetic applications. Its stability under standard conditions, along with its potential for further functionalization, makes it a valuable intermediate in organic synthesis. As with many nitro compounds, care should be taken regarding its handling and storage due to potential hazards associated with nitro groups.
Formula:C9H9NO5
InChI:InChI=1/C9H9NO5/c1-14-8-4-3-6(9(11)15-2)5-7(8)10(12)13/h3-5H,1-2H3
InChI key:ZUZYMTBOKNSYEB-UHFFFAOYSA-N
SMILES:COc1ccc(cc1N(=O)=O)C(=O)OC
Found 7 products.