CymitQuimica logo

CAS 40787-96-0

:

3-Bromo-4-nitroaniline

Description:
3-Bromo-4-nitroaniline is an organic compound characterized by the presence of both bromine and nitro functional groups attached to an aniline structure. Its molecular formula is C6H5BrN2O2, indicating that it contains six carbon atoms, five hydrogen atoms, one bromine atom, two nitrogen atoms, and two oxygen atoms. This compound typically appears as a solid, often with a yellow to brown color due to the nitro group. It is known for its applications in organic synthesis, particularly in the production of dyes and pharmaceuticals. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the nitro group contributes to its electron-withdrawing properties, influencing its reactivity and solubility in different solvents. Safety precautions should be taken when handling this compound, as it may pose health risks, including potential toxicity. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C6H5BrN2O2
InChI:InChI=1/C6H5BrN2O2/c7-5-3-4(8)1-2-6(5)9(10)11/h1-3H,8H2
InChI key:RLAIFIDRVAAEBW-UHFFFAOYSA-N
SMILES:c1cc(c(cc1N)Br)N(=O)=O
Synonyms:
  • 4-Nitro-3-bromoaniline
Found 4 products.