CAS 40800-65-5
:Ethyl 4-amino-3-methylbenzoate
Description:
Ethyl 4-amino-3-methylbenzoate, also known as ethyl 4-amino-3-toluate, is an organic compound characterized by its ester functional group and an aromatic ring. It features an ethyl group attached to the carboxylate portion, while the aromatic ring has an amino group and a methyl group in the para and meta positions, respectively. This compound is typically a white to off-white solid and is soluble in organic solvents, with limited solubility in water due to its hydrophobic aromatic structure. Ethyl 4-amino-3-methylbenzoate is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its amino group can participate in various chemical reactions, such as acylation or alkylation, making it a versatile building block in synthetic chemistry. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.
Formula:C10H13NO2
InChI:InChI=1/C10H13NO2/c1-3-13-10(12)8-4-5-9(11)7(2)6-8/h4-6H,3,11H2,1-2H3
SMILES:CCOC(=O)c1ccc(c(C)c1)N
Synonyms:- Benzoic acid, 4-amino-3-methyl-, ethyl ester
- Ethyl 4-amino-3-methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Benzoic acid, 4-amino-3-methyl-, ethyl ester
CAS:Formula:C10H13NO2Purity:98%Color and Shape:SolidMolecular weight:179.2157Ethyl 4-amino-3-methylbenzoate
CAS:Ethyl 4-amino-3-methylbenzoateFormula:C10H13NO2Purity:98%Molecular weight:179.22Ethyl 4-amino-3-methylbenzoate
CAS:Ethyl 4-amino-3-methylbenzoateFormula:C10H13NO2Purity:98%Color and Shape:SolidMolecular weight:179.21572Ethyl-4-amino-3-methylbenzoate
CAS:Formula:C10H13NO2Purity:95%Color and Shape:SolidMolecular weight:179.219Ethyl 4-amino-3-methylbenzoate
CAS:Ethyl 4-amino-3-methylbenzoate is a dimer that can be formed by the reaction of ethyl benzoate with anilines. This dimer has been shown to have an asymmetric center and can form hydrogen bonds with other molecules. The reactivity of this molecule is similar to benzocaine, which is also a dimer, but it does not contain any nitrogen atoms.
Formula:C10H13NO2Purity:Min. 95%Molecular weight:179.22 g/mol




