CAS 408309-29-5

3-(1H-pyrrol-2-yl)propanoic acid

Description:

3-(1H-pyrrol-2-yl)propanoic acid, with the CAS number 408309-29-5, is an organic compound characterized by its pyrrole ring structure attached to a propanoic acid moiety. This compound features a five-membered aromatic ring containing nitrogen, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) makes it an acidic compound, capable of donating protons in solution. Its molecular structure allows for potential interactions through hydrogen bonding, which can influence its solubility and reactivity. The pyrrole ring can participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structural features suggest potential applications in materials science and organic synthesis. Overall, 3-(1H-pyrrol-2-yl)propanoic acid is a versatile compound with significant implications in both chemical and biological contexts.

Formula: C₇H₉NO₂

InChI: InChI=1/C7H9NO2/c9-7(10)4-3-6-2-1-5-8-6/h1-2,5,8H,3-4H2,(H,9,10)

SMILES: c1cc(CCC(=O)O)[nH]c1

Synonyms:

• 1H-pyrrole-2-propanoic acid
• 3-(1H-Pyrrol-2-yl)propanoicacid

3-(1H-Pyrrol-2-yl)propanoic acid

CAS: 408309-29-5

Formula: C₇H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.1519

Ref: IN-DA00CIQS

3-(1H-Pyrrol-2-yl)propanoic acid

CAS: 408309-29-5

3-(1H-Pyrrol-2-yl)propanoic acid

Purity: 98%

Molecular weight: 139.15g/mol

Ref: 54-OR95009

3-(1H-Pyrrol-2-yl)propanoic acid

CAS: 408309-29-5

Formula: C₇H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 139.154

Ref: 10-F080287

CEP03

CAS: 408309-29-5

CEP03 boosts angiogenesis, aids mice limb blood flow recovery by enhancing EC/EPC growth, and wound healing.

Formula: C₇H₉NO₂

Color and Shape: Solid

Molecular weight: 139.15

Ref: TM-T21185