CymitQuimica logo

CAS 408309-29-5

:

3-(1H-pyrrol-2-yl)propanoic acid

Description:
3-(1H-pyrrol-2-yl)propanoic acid, with the CAS number 408309-29-5, is an organic compound characterized by its pyrrole ring structure attached to a propanoic acid moiety. This compound features a five-membered aromatic ring containing nitrogen, which contributes to its unique chemical properties. The presence of the carboxylic acid functional group (-COOH) makes it an acidic compound, capable of donating protons in solution. Its molecular structure allows for potential interactions through hydrogen bonding, which can influence its solubility and reactivity. The pyrrole ring can participate in various chemical reactions, including electrophilic substitutions and coordination with metal ions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Additionally, its structural features suggest potential applications in materials science and organic synthesis. Overall, 3-(1H-pyrrol-2-yl)propanoic acid is a versatile compound with significant implications in both chemical and biological contexts.
Formula:C7H9NO2
InChI:InChI=1/C7H9NO2/c9-7(10)4-3-6-2-1-5-8-6/h1-2,5,8H,3-4H2,(H,9,10)
InChI key:XDNDSAQVXNZKGP-UHFFFAOYSA-N
SMILES:c1cc(CCC(=O)O)[nH]c1
Synonyms:
  • 1H-pyrrole-2-propanoic acid
  • 3-(1H-Pyrrol-2-yl)propanoicacid
Found 5 products.